
CAS 1220034-40-1
:3-Piperidinamine, N,N-diethyl-, hydrochloride (1:2)
Description:
3-Piperidinamine, N,N-diethyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features two ethyl groups attached to the nitrogen atom of the piperidine, contributing to its amine properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and makes it suitable for various applications, particularly in pharmaceutical formulations. The presence of the hydrochloride indicates that the compound can exist in a protonated state, which can influence its reactivity and interaction with biological systems. This substance may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its pharmacological profile. Its specific applications and biological activity would depend on further studies, but compounds of this nature are often explored for their potential in medicinal chemistry and drug development. Safety and handling precautions should be observed due to the potential reactivity of amines.
Formula:C9H20N2·2ClH
InChI:InChI=1S/C9H20N2.2ClH/c1-3-11(4-2)9-6-5-7-10-8-9;;/h9-10H,3-8H2,1-2H3;2*1H
InChI key:InChIKey=DBBSMADIHVDOKJ-UHFFFAOYSA-N
SMILES:N(CC)(CC)C1CCCNC1.Cl
Synonyms:- 3-Piperidinamine, N,N-diethyl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.