CAS 1220034-41-2
:5-Bromo-N-(1,1-dimethylethyl)-2-pyridinamine
Description:
5-Bromo-N-(1,1-dimethylethyl)-2-pyridinamine is an organic compound characterized by its bromine substitution on the pyridine ring and a tert-butyl group attached to the nitrogen atom. This compound features a pyridinamine structure, which consists of a six-membered aromatic ring containing one nitrogen atom and an amino group (-NH2) at the 2-position. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and solubility. The tert-butyl group contributes to steric hindrance, potentially affecting the compound's interactions with other molecules. This substance may exhibit properties typical of both amines and halogenated compounds, such as basicity and potential for nucleophilic substitution reactions. It is important in various chemical applications, including pharmaceuticals and agrochemicals, where its unique structure can impart specific biological activities or enhance the efficacy of other compounds. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.
Formula:C9H13BrN2
InChI:InChI=1S/C9H13BrN2/c1-9(2,3)12-8-5-4-7(10)6-11-8/h4-6H,1-3H3,(H,11,12)
InChI key:InChIKey=FNLCZRYQMLOAKX-UHFFFAOYSA-N
SMILES:N(C(C)(C)C)C1=CC=C(Br)C=N1
Synonyms:- 5-Bromo-N-(1,1-dimethylethyl)-2-pyridinamine
- 2-Pyridinamine, 5-bromo-N-(1,1-dimethylethyl)-
- 5-BROMO-N-(TERT-BUTYL)PYRIDIN-2-AMINE
- N-(5-Bromo-2-pyridinyl)-N-(tert-butyl)amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.