CymitQuimica logo

CAS 1220034-42-3

:

Pyrazine, 2-chloro-6-(4-piperidinylmethoxy)-, hydrochloride (1:1)

Description:
Pyrazine, 2-chloro-6-(4-piperidinylmethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine atom at the 2-position and a piperidinylmethoxy group at the 6-position contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Safety and handling precautions are essential due to the presence of chlorine and the potential for biological activity. As with many chemical substances, further studies are necessary to fully understand its properties, mechanisms of action, and potential applications in drug development.
Formula:C10H14ClN3O·ClH
InChI:InChI=1S/C10H14ClN3O.ClH/c11-9-5-13-6-10(14-9)15-7-8-1-3-12-4-2-8;/h5-6,8,12H,1-4,7H2;1H
InChI key:InChIKey=DAWOHUWWWPSERK-UHFFFAOYSA-N
SMILES:O(CC1CCNCC1)C2=NC(Cl)=CN=C2.Cl
Synonyms:
  • Pyrazine, 2-chloro-6-(4-piperidinylmethoxy)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.