
CAS 1220034-50-3
:Pyridine, 3-(3-piperidinyloxy)-, hydrochloride (1:1)
Description:
Pyridine, 3-(3-piperidinyloxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and piperidine moieties, which contribute to its unique properties. As a hydrochloride salt, it is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents. The presence of the piperidinyloxy group enhances its potential as a pharmacological agent, often studied for its biological activity, including effects on neurotransmitter systems. This compound may exhibit basic properties due to the nitrogen atoms in its structure, allowing it to participate in various chemical reactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting central nervous system disorders. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound represents an interesting intersection of organic chemistry and pharmacology, warranting further investigation for its therapeutic potential.
Formula:C10H14N2O·ClH
InChI:InChI=1S/C10H14N2O.ClH/c1-3-9(7-11-5-1)13-10-4-2-6-12-8-10;/h1,3,5,7,10,12H,2,4,6,8H2;1H
InChI key:InChIKey=YSEHHDOHXVITFI-UHFFFAOYSA-N
SMILES:O(C1CCCNC1)C=2C=CC=NC2.Cl
Synonyms:- Pyridine, 3-(3-piperidinyloxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.