
CAS 1220034-54-7
:2-Butanol, 4-[(3-amino-2-pyridinyl)amino]-
Description:
2-Butanol, 4-[(3-amino-2-pyridinyl)amino]- is an organic compound characterized by its structure, which includes a butanol moiety and a pyridine ring substituted with an amino group. This compound features a hydroxyl (-OH) group, which contributes to its classification as an alcohol, and the presence of the pyridine ring introduces heteroatoms, enhancing its potential for various chemical interactions. The amino group attached to the pyridine ring can participate in hydrogen bonding and may influence the compound's solubility and reactivity. Typically, such compounds exhibit moderate polarity due to the hydroxyl group, which can affect their boiling and melting points. Additionally, the presence of both the alcohol and amino functionalities suggests potential applications in pharmaceuticals or as intermediates in organic synthesis. The compound's specific properties, such as its reactivity, stability, and biological activity, would depend on its molecular interactions and the surrounding environment. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C9H15N3O
InChI:InChI=1S/C9H15N3O/c1-7(13)4-6-12-9-8(10)3-2-5-11-9/h2-3,5,7,13H,4,6,10H2,1H3,(H,11,12)
InChI key:InChIKey=CJOBFPBTBMDGFX-UHFFFAOYSA-N
SMILES:N(CCC(C)O)C1=C(N)C=CC=N1
Synonyms:- 2-Butanol, 4-[(3-amino-2-pyridinyl)amino]-
- 4-[(3-Aminopyridin-2-yl)amino]butan-2-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.