CymitQuimica logo

CAS 1220034-55-8

:

Piperidine, 4-(4-methyl-2-nitrophenoxy)-, hydrochloride (1:1)

Description:
Piperidine, 4-(4-methyl-2-nitrophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 4-(4-methyl-2-nitrophenoxy) substituent, indicating the presence of a nitrophenyl group that is further substituted with a methyl group, contributing to its unique chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the nitro group suggests potential reactivity and biological activity, making it of interest in medicinal chemistry. The compound's molecular structure influences its physical properties, such as melting point and solubility, while its functional groups can affect its reactivity and interaction with biological systems. Safety and handling precautions should be observed due to the potential toxicity associated with nitro compounds.
Formula:C12H16N2O3·ClH
InChI:InChI=1S/C12H16N2O3.ClH/c1-9-2-3-12(11(8-9)14(15)16)17-10-4-6-13-7-5-10;/h2-3,8,10,13H,4-7H2,1H3;1H
InChI key:InChIKey=OMIVAFWXDDBARW-UHFFFAOYSA-N
SMILES:O(C1=C(N(=O)=O)C=C(C)C=C1)C2CCNCC2.Cl
Synonyms:
  • Piperidine, 4-(4-methyl-2-nitrophenoxy)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.