CAS 1220034-59-2

3-Piperidineethanamine, N-ethyl-N-(phenylmethyl)-, hydrochloride (1:2)

Description:

3-Piperidineethanamine, N-ethyl-N-(phenylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and ethylamine functional groups, which contribute to its potential biological activity. The presence of the phenylmethyl group enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including pharmaceuticals and research. The compound may exhibit properties such as being a potential ligand for neurotransmitter receptors, which could make it of interest in medicinal chemistry. Its molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, affecting its pharmacokinetics and pharmacodynamics. Safety and handling precautions are essential, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties, mechanisms of action, and potential therapeutic applications.

Formula: C₁₆H₂₆N₂·2ClH

InChI: InChI=1S/C16H26N2.2ClH/c1-2-18(14-16-7-4-3-5-8-16)12-10-15-9-6-11-17-13-15;;/h3-5,7-8,15,17H,2,6,9-14H2,1H3;2*1H

InChI key: InChIKey=WITVXEYVGWDENH-UHFFFAOYSA-N

SMILES: C(N(CCC1CCCNC1)CC)C2=CC=CC=C2.Cl

Synonyms:

• 3-Piperidineethanamine, N-ethyl-N-(phenylmethyl)-, hydrochloride (1:2)