CAS 1220034-73-0

Benzoic acid, 2-[(4-piperidinylmethoxy)methyl]-, methyl ester, hydrochloride (1:1)

Description:

Benzoic acid, 2-[(4-piperidinylmethoxy)methyl]-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety, a piperidine ring, and a methyl ester functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols due to the presence of the hydrochloride salt form. The piperidine ring contributes to its potential biological activity, making it of interest in pharmaceutical research. The compound may exhibit properties such as antimicrobial or analgesic effects, although specific biological activities would depend on further empirical studies. Its hydrochloride form enhances stability and solubility, facilitating its use in various applications, including drug formulation. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, this compound represents a unique combination of functional groups that may lead to diverse applications in medicinal chemistry.

Formula: C₁₅H₂₁NO₃·ClH

InChI: InChI=1S/C15H21NO3.ClH/c1-18-15(17)14-5-3-2-4-13(14)11-19-10-12-6-8-16-9-7-12;/h2-5,12,16H,6-11H2,1H3;1H

InChI key: InChIKey=OQLVTXDLVGGAER-UHFFFAOYSA-N

SMILES: C(OCC1CCNCC1)C2=C(C(OC)=O)C=CC=C2.Cl

Synonyms:

• Benzoic acid, 2-[(4-piperidinylmethoxy)methyl]-, methyl ester, hydrochloride (1:1)