CAS 1220034-75-2

Propanamide, 3-amino-N-butyl-N-methyl-, hydrochloride (1:1)

Description:

Propanamide, 3-amino-N-butyl-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar molecule. The presence of both butyl and methyl groups contributes to its hydrophobic characteristics, while the amino group enhances its solubility in polar solvents. As a hydrochloride salt, it exists as a stable, ionic form, which typically increases its solubility in water compared to its free base form. This compound may exhibit biological activity due to the amino group, which can participate in hydrogen bonding and interact with biological targets. Its molecular structure suggests potential applications in pharmaceuticals or as a biochemical reagent. Additionally, the compound's stability and solubility profile make it suitable for various laboratory and industrial applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₁₈N₂O·ClH

InChI: InChI=1S/C8H18N2O.ClH/c1-3-4-7-10(2)8(11)5-6-9;/h3-7,9H2,1-2H3;1H

InChI key: InChIKey=BPVPUXQHKGXPDC-UHFFFAOYSA-N

SMILES: N(C(CCN)=O)(CCCC)C.Cl

Synonyms:

• Propanamide, 3-amino-N-butyl-N-methyl-, hydrochloride (1:1)