CAS 1220034-89-8

2-Piperazinone, 4-(2-amino-2-methyl-1-oxopropyl)-, hydrochloride (1:1)

Description:

2-Piperazinone, 4-(2-amino-2-methyl-1-oxopropyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperazinone core, which is a bicyclic structure containing a piperazine ring and a ketone functional group. This compound features an amino acid-like side chain, contributing to its potential biological activity. The hydrochloride salt form indicates that it is a hydrochloride salt, which typically enhances solubility in water and may influence its pharmacokinetic properties. The presence of the amino group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may confer specific properties such as stability, reactivity, and the ability to form hydrogen bonds, which are crucial for its function in biological systems. As with many piperazine derivatives, it may exhibit a range of pharmacological activities, including effects on the central nervous system or antimicrobial properties. However, detailed studies would be necessary to elucidate its specific biological effects and applications.

Formula: C₈H₁₅N₃O₂·ClH

InChI: InChI=1S/C8H15N3O2.ClH/c1-8(2,9)7(13)11-4-3-10-6(12)5-11;/h3-5,9H2,1-2H3,(H,10,12);1H

InChI key: InChIKey=PRCHJUDEFQDPGH-UHFFFAOYSA-N

SMILES: C(C(C)(C)N)(=O)N1CC(=O)NCC1.Cl

Synonyms:

• 2-Piperazinone, 4-(2-amino-2-methyl-1-oxopropyl)-, hydrochloride (1:1)