
CAS 1220034-92-3
:Piperidine, 3-[[(2,4-difluorophenyl)methoxy]methyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[[(2,4-difluorophenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a difluorophenyl group and a methoxy methyl substituent contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The difluorophenyl moiety may influence the compound's lipophilicity and receptor binding characteristics, making it of interest in medicinal chemistry. This compound may exhibit various pharmacological effects, potentially acting as a ligand for specific receptors or enzymes. Its synthesis and characterization would involve standard organic chemistry techniques, and safety precautions should be observed due to the presence of fluorine, which can impart toxicity. Overall, this compound's structural features suggest it may have applications in drug development or as a research chemical in the study of biological systems.
Formula:C13H17F2NO·ClH
InChI:InChI=1S/C13H17F2NO.ClH/c14-12-4-3-11(13(15)6-12)9-17-8-10-2-1-5-16-7-10;/h3-4,6,10,16H,1-2,5,7-9H2;1H
InChI key:InChIKey=XJWCFAJOHAZNPC-UHFFFAOYSA-N
SMILES:C(OCC1CCCNC1)C2=C(F)C=C(F)C=C2.Cl
Synonyms:- Piperidine, 3-[[(2,4-difluorophenyl)methoxy]methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.