CAS 1220034-93-4

Propanamide, 2-amino-N,2-dimethyl-N-(phenylmethyl)-, hydrochloride (1:1)

Description:

Propanamide, 2-amino-N,2-dimethyl-N-(phenylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar molecule with hydrogen bonding capabilities. The presence of the dimethyl and phenylmethyl substituents suggests that it has a complex structure, contributing to its lipophilicity and potential interactions with biological systems. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit properties typical of amines and amides, such as basicity and the ability to participate in nucleophilic reactions. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the precise molecular interactions and the environment in which it is studied. Overall, this compound may have relevance in medicinal chemistry, particularly in the development of therapeutic agents.

Formula: C₁₂H₁₈N₂O·ClH

InChI: InChI=1S/C12H18N2O.ClH/c1-12(2,13)11(15)14(3)9-10-7-5-4-6-8-10;/h4-8H,9,13H2,1-3H3;1H

InChI key: InChIKey=KDIWDBAPKLKFSN-UHFFFAOYSA-N

SMILES: C(N(C(C(C)(C)N)=O)C)C1=CC=CC=C1.Cl

Synonyms:

• Propanamide, 2-amino-N,2-dimethyl-N-(phenylmethyl)-, hydrochloride (1:1)