CAS 1220034-99-0

2-(Ethylsulfonyl)-5-(4-morpholinyl)benzenamine

Description:

2-(Ethylsulfonyl)-5-(4-morpholinyl)benzenamine, identified by its CAS number 1220034-99-0, is a chemical compound characterized by its unique functional groups and structural features. It contains an ethylsulfonyl group, which contributes to its solubility and reactivity, and a morpholine ring, which enhances its biological activity and potential as a pharmaceutical agent. The presence of the amine group allows for hydrogen bonding, influencing its interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the sulfonyl and amine functionalities. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, 2-(Ethylsulfonyl)-5-(4-morpholinyl)benzenamine represents a versatile scaffold for further chemical modifications and investigations in various fields, including pharmacology and organic synthesis.

Formula: C₁₂H₁₈N₂O₃S

InChI: InChI=1S/C12H18N2O3S/c1-2-18(15,16)12-4-3-10(9-11(12)13)14-5-7-17-8-6-14/h3-4,9H,2,5-8,13H2,1H3

InChI key: InChIKey=UTTLXRROTGARJY-UHFFFAOYSA-N

SMILES: NC=1C=C(C=CC1S(CC)(=O)=O)N2CCOCC2

Synonyms:

• 2-(Ethylsulfonyl)-5-(4-morpholinyl)benzenamine
• Benzenamine, 2-(ethylsulfonyl)-5-(4-morpholinyl)-