CAS 1220035-04-0

1H-Pyrazolo[4,3-c]pyridine-3-carboxamide, N-ethyl-4,5,6,7-tetrahydro-, hydrochloride (1:1)

Description:

1H-Pyrazolo[4,3-c]pyridine-3-carboxamide, N-ethyl-4,5,6,7-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyridine moieties. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the carboxamide functional group and the hydrochloride salt form, which enhances its stability and bioavailability. The N-ethyl substitution contributes to its pharmacological profile, potentially influencing its interaction with biological targets. As a hydrochloride salt, it is likely to be more stable and easier to handle in laboratory settings. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods and may vary based on purity and formulation. Overall, this compound represents a class of heterocyclic compounds that are significant in various chemical and biological applications.

Formula: C₉H₁₄N₄O·ClH

InChI: InChI=1S/C9H14N4O.ClH/c1-2-11-9(14)8-6-5-10-4-3-7(6)12-13-8;/h10H,2-5H2,1H3,(H,11,14)(H,12,13);1H

InChI key: InChIKey=CQICJGGPHBBLEE-UHFFFAOYSA-N

SMILES: C(NCC)(=O)C=1C2=C(NN1)CCNC2.Cl

Synonyms:

• 1H-Pyrazolo[4,3-c]pyridine-3-carboxamide, N-ethyl-4,5,6,7-tetrahydro-, hydrochloride (1:1)