
CAS 1220035-08-4
:Acetamide, 2-amino-N-(2-hydroxy-1,1-dimethylethyl)-, hydrochloride (1:1)
Description:
Acetamide, 2-amino-N-(2-hydroxy-1,1-dimethylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar solvent and its ability to participate in hydrogen bonding. The presence of the amino group suggests that it can act as a base, while the hydroxyl group contributes to its solubility in water and may enhance its reactivity. The hydrochloride form indicates that it is a salt, which typically enhances stability and solubility in aqueous solutions. This compound may exhibit biological activity due to its structural features, making it of interest in pharmaceutical applications. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. As with many amides, it may also have applications in organic synthesis and as a building block in the preparation of more complex molecules. Safety data and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards.
Formula:C6H14N2O2·ClH
InChI:InChI=1S/C6H14N2O2.ClH/c1-6(2,4-9)8-5(10)3-7;/h9H,3-4,7H2,1-2H3,(H,8,10);1H
InChI key:InChIKey=WXQVTGZHHPIQJP-UHFFFAOYSA-N
SMILES:C(NC(CN)=O)(CO)(C)C.Cl
Synonyms:- Acetamide, 2-amino-N-(2-hydroxy-1,1-dimethylethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.