CAS 1220035-09-5

5-Bromo-N-(3-methoxypropyl)-3-methyl-2-pyridinamine

Description:

5-Bromo-N-(3-methoxypropyl)-3-methyl-2-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methoxypropyl group at the nitrogen atom contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the methoxy group, which can participate in hydrogen bonding. The methyl group at the 3-position may influence its steric hindrance and reactivity. As a pyridinamine, it may also display basic properties due to the nitrogen atom in the ring, which can accept protons. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as derivatives of pyridine are often explored for their biological activities. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular conformation. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₀H₁₅BrN₂O

InChI: InChI=1S/C10H15BrN2O/c1-8-6-9(11)7-13-10(8)12-4-3-5-14-2/h6-7H,3-5H2,1-2H3,(H,12,13)

InChI key: InChIKey=KCTRJRXRIZQVTI-UHFFFAOYSA-N

SMILES: N(CCCOC)C1=C(C)C=C(Br)C=N1

Synonyms:

• 2-Pyridinamine, 5-bromo-N-(3-methoxypropyl)-3-methyl-
• 5-Bromo-N-(3-methoxypropyl)-3-methyl-2-pyridinamine