CAS 1220035-12-0

Acetamide, N-(3-methoxypropyl)-2-(methylamino)-, hydrochloride (1:1)

Description:

Acetamide, N-(3-methoxypropyl)-2-(methylamino)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar solvent and its ability to form hydrogen bonds. The presence of a methoxypropyl group suggests that it may exhibit moderate hydrophobic characteristics, while the methylamino group contributes to its basicity and potential reactivity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit biological activity, potentially acting as a ligand or modulator in biochemical pathways. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and acylation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties, biological activity, and potential applications in research or industry.

Formula: C₇H₁₆N₂O₂·ClH

InChI: InChI=1S/C7H16N2O2.ClH/c1-8-6-7(10)9-4-3-5-11-2;/h8H,3-6H2,1-2H3,(H,9,10);1H

InChI key: InChIKey=GBZBAMZJXABBBX-UHFFFAOYSA-N

SMILES: C(NCCCOC)(CNC)=O.Cl

Synonyms:

• Acetamide, N-(3-methoxypropyl)-2-(methylamino)-, hydrochloride (1:1)