CymitQuimica logo

CAS 1220035-16-4

:

N2-(5-Bromo-3-methyl-2-pyridinyl)-N1,N1-dimethyl-1,2-ethanediamine

Description:
N2-(5-Bromo-3-methyl-2-pyridinyl)-N1,N1-dimethyl-1,2-ethanediamine, identified by its CAS number 1220035-16-4, is a chemical compound that features a pyridine ring substituted with a bromine atom and a methyl group, along with a dimethylated ethanediamine moiety. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its role as a pharmacophore. The presence of the bromine atom may enhance lipophilicity and influence the compound's interaction with biological targets. The dimethylated ethanediamine structure contributes to its basicity and solubility in polar solvents. Additionally, the compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which are critical for its biological efficacy. Overall, this compound's unique structural features make it a subject of interest in drug discovery and development, particularly in the context of targeting specific receptors or enzymes in various therapeutic areas.
Formula:C10H16BrN3
InChI:InChI=1S/C10H16BrN3/c1-8-6-9(11)7-13-10(8)12-4-5-14(2)3/h6-7H,4-5H2,1-3H3,(H,12,13)
InChI key:InChIKey=CLSSTPKJOXBTKU-UHFFFAOYSA-N
SMILES:N(CCN(C)C)C1=C(C)C=C(Br)C=N1
Synonyms:
  • 1,2-Ethanediamine, N2-(5-bromo-3-methyl-2-pyridinyl)-N1,N1-dimethyl-
  • N2-(5-Bromo-3-methyl-2-pyridinyl)-N1,N1-dimethyl-1,2-ethanediamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.