CymitQuimica logo

CAS 1220035-29-9

:

Piperidine, 3-[[(3-bromo[1,1′-biphenyl]-4-yl)oxy]methyl]-, hydrochloride (1:1)

Description:
Piperidine, 3-[[[3-bromo[1,1′-biphenyl]-4-yl]oxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a brominated biphenyl moiety contributes to its unique properties, potentially influencing its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The compound may exhibit specific pharmacological effects due to the structural features imparted by the piperidine and biphenyl groups, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Safety and handling precautions are essential, as with many chemical substances, particularly those containing halogens and nitrogen heterocycles, due to potential toxicity and environmental impact.
Formula:C18H20BrNO·ClH
InChI:InChI=1S/C18H20BrNO.ClH/c19-17-11-16(15-6-2-1-3-7-15)8-9-18(17)21-13-14-5-4-10-20-12-14;/h1-3,6-9,11,14,20H,4-5,10,12-13H2;1H
InChI key:InChIKey=VHFPTOCAVOJPSE-UHFFFAOYSA-N
SMILES:BrC=1C=C(C=CC1OCC2CCCNC2)C3=CC=CC=C3.Cl
Synonyms:
  • Piperidine, 3-[[(3-bromo[1,1′-biphenyl]-4-yl)oxy]methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.