CAS 1220035-42-6

Propanamide, 2-amino-2-methyl-N-(4-pyridinylmethyl)-, hydrochloride (1:1)

Description:

Propanamide, 2-amino-2-methyl-N-(4-pyridinylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar molecule with hydrogen bonding capabilities. The presence of the pyridine ring suggests that it may exhibit aromatic properties, contributing to its stability and reactivity. This compound is likely to be soluble in polar solvents due to its hydrochloride form, which enhances its ionic character. The amino group in its structure can participate in various chemical reactions, including nucleophilic substitutions and protonation, making it versatile in synthetic applications. Additionally, the presence of the methyl group adjacent to the amine may influence its steric hindrance and overall reactivity. As a hydrochloride salt, it is expected to have enhanced stability and shelf-life compared to its free base form. Overall, this compound may have potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities would require further investigation.

Formula: C₁₀H₁₅N₃O·ClH

InChI: InChI=1S/C10H15N3O.ClH/c1-10(2,11)9(14)13-7-8-3-5-12-6-4-8;/h3-6H,7,11H2,1-2H3,(H,13,14);1H

InChI key: InChIKey=BFOCZJQOZSARQS-UHFFFAOYSA-N

SMILES: C(NC(C(C)(C)N)=O)C=1C=CN=CC1.Cl

Synonyms:

• Propanamide, 2-amino-2-methyl-N-(4-pyridinylmethyl)-, hydrochloride (1:1)