CAS 1220035-45-9

Propanamide, 3-amino-N-(4-fluorophenyl)-, hydrochloride (1:1)

Description:

Propanamide, 3-amino-N-(4-fluorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from propanoic acid. This substance features an amino group attached to the propanamide backbone, enhancing its potential for biological activity. The presence of a 4-fluorophenyl group indicates that it has a fluorine atom substituted on a phenyl ring, which can influence its pharmacological properties, such as lipophilicity and receptor binding affinity. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including pharmaceuticals. The compound may exhibit properties such as moderate to high melting points and stability under standard conditions, although specific thermal and solubility characteristics would depend on the precise molecular interactions. Its potential applications could span medicinal chemistry, particularly in the development of therapeutic agents, given the structural features that suggest possible interactions with biological targets. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₉H₁₁FN₂O·ClH

InChI: InChI=1S/C9H11FN2O.ClH/c10-7-1-3-8(4-2-7)12-9(13)5-6-11;/h1-4H,5-6,11H2,(H,12,13);1H

InChI key: InChIKey=OIGOMLASAVYITL-UHFFFAOYSA-N

SMILES: N(C(CCN)=O)C1=CC=C(F)C=C1.Cl

Synonyms:

• Propanamide, 3-amino-N-(4-fluorophenyl)-, hydrochloride (1:1)