CymitQuimica logo

CAS 1220035-49-3

:

2-Chloro-N-[(tetrahydro-2H-pyran-4-yl)methyl]-3-pyridinecarboxamide

Description:
2-Chloro-N-[(tetrahydro-2H-pyran-4-yl)methyl]-3-pyridinecarboxamide is a chemical compound characterized by its unique structural features, which include a pyridine ring, a carboxamide functional group, and a chloro substituent. The presence of the tetrahydro-2H-pyran moiety contributes to its potential biological activity, as this bicyclic structure can influence the compound's interaction with biological targets. The chloro group may enhance lipophilicity and affect the compound's solubility and reactivity. This compound is likely to exhibit specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in areas such as agrochemicals or pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. As with many organic compounds, its stability, reactivity, and biological activity would depend on various factors, including environmental conditions and the presence of other chemical entities. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C12H15ClN2O2
InChI:InChI=1S/C12H15ClN2O2/c13-11-10(2-1-5-14-11)12(16)15-8-9-3-6-17-7-4-9/h1-2,5,9H,3-4,6-8H2,(H,15,16)
InChI key:InChIKey=YGNIYXKPAXQEAB-UHFFFAOYSA-N
SMILES:C(NCC1CCOCC1)(=O)C2=C(Cl)N=CC=C2
Synonyms:
  • 2-Chloro-N-[(tetrahydro-2H-pyran-4-yl)methyl]-3-pyridinecarboxamide
  • 3-Pyridinecarboxamide, 2-chloro-N-[(tetrahydro-2H-pyran-4-yl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.