
CAS 1220035-55-1
:Pyrrolidine, 3-(2-chloro-4,6-dimethylphenoxy)-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-(2-chloro-4,6-dimethylphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine core, which is a five-membered saturated heterocyclic amine. The presence of a 2-chloro-4,6-dimethylphenoxy group indicates that it has a substituted aromatic ring, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in pharmaceutical applications. The compound may exhibit properties such as being a potential ligand or inhibitor in various biochemical pathways, although specific biological activities would depend on further empirical studies. Its molecular structure suggests it could interact with various receptors or enzymes, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential pharmacological effects.
Formula:C12H16ClNO·ClH
InChI:InChI=1S/C12H16ClNO.ClH/c1-8-5-9(2)12(11(13)6-8)15-10-3-4-14-7-10;/h5-6,10,14H,3-4,7H2,1-2H3;1H
InChI key:InChIKey=QGJNKRDDHYGIJR-UHFFFAOYSA-N
SMILES:O(C1=C(C)C=C(C)C=C1Cl)C2CCNC2.Cl
Synonyms:- Pyrrolidine, 3-(2-chloro-4,6-dimethylphenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.