CAS 1220035-59-5

Acetamide, N-(2-furanylmethyl)-2-(methylamino)-, hydrochloride (1:1)

Description:

Acetamide, N-(2-furanylmethyl)-2-(methylamino)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid. The presence of a furan ring indicates that it has heterocyclic properties, contributing to its potential reactivity and biological activity. The methylamino group suggests that it can participate in various chemical reactions, including nucleophilic substitutions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could lead to therapeutic effects. However, detailed studies would be necessary to fully understand its biological activity, toxicity, and potential applications. As with any chemical substance, proper handling and safety measures should be observed due to the potential for hazardous effects.

Formula: C₈H₁₂N₂O₂·ClH

InChI: InChI=1S/C8H12N2O2.ClH/c1-9-6-8(11)10-5-7-3-2-4-12-7;/h2-4,9H,5-6H2,1H3,(H,10,11);1H

InChI key: InChIKey=XETNKUZIYCNBKF-UHFFFAOYSA-N

SMILES: C(NC(CNC)=O)C1=CC=CO1.Cl

Synonyms:

• Acetamide, N-(2-furanylmethyl)-2-(methylamino)-, hydrochloride (1:1)

N-(Furan-2-ylmethyl)-2-(methylamino)acetamide hydrochloride

CAS: 1220035-59-5

Versatile small molecule scaffold

Formula: C₈H₁₃ClN₂O₂

Purity: Min. 95%

Molecular weight: 204.65 g/mol

Ref: 3D-VYB03559