CAS 1220035-62-0

2-Piperidineethanamine, N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:2)

Description:

2-Piperidineethanamine, N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a piperidine ring and a tetrahydro-pyran moiety. This substance is typically classified as an amine due to the presence of the amine functional group, which contributes to its basicity and potential for forming salts, such as the hydrochloride form. The compound's molecular structure suggests it may exhibit properties relevant to medicinal chemistry, potentially influencing its pharmacological activity. Its hydrochloride salt form enhances solubility in aqueous solutions, making it suitable for various applications, including research and development in drug formulation. The presence of both piperidine and tetrahydropyran rings may impart unique steric and electronic properties, influencing interactions with biological targets. As with many amines, it may also participate in hydrogen bonding, affecting its reactivity and stability. Safety data and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₄H₂₈N₂O·2ClH

InChI: InChI=1S/C14H28N2O.2ClH/c1-16(12-13-6-10-17-11-7-13)9-5-14-4-2-3-8-15-14;;/h13-15H,2-12H2,1H3;2*1H

InChI key: InChIKey=XVJYCEZHYYJAQJ-UHFFFAOYSA-N

SMILES: C(N(CCC1CCCCN1)C)C2CCOCC2.Cl

Synonyms:

• 2-Piperidineethanamine, N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:2)