CymitQuimica logo

CAS 1220035-65-3

:

3-Piperidineethanamine, N,N-dipropyl-, hydrochloride (1:2)

Description:
3-Piperidineethanamine, N,N-dipropyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and ethylamine functional groups, which contribute to its basicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of dipropyl groups suggests that the compound may exhibit lipophilic properties, potentially influencing its pharmacokinetics and interaction with biological membranes. This compound may be of interest in medicinal chemistry for its potential role in drug development, particularly in the context of neuropharmacology, given the structural similarities to other amines that interact with neurotransmitter systems. Its specific characteristics, such as melting point, boiling point, and spectral data, would be essential for further applications and studies, but these details are typically found in specialized chemical databases or literature. As with any chemical, proper handling and safety protocols should be observed due to its potential biological effects.
Formula:C13H29ClN2
InChI:InChI=1S/C13H28N2.2ClH/c1-3-9-15(10-4-2)11-7-13-6-5-8-14-12-13;;/h13-14H,3-12H2,1-2H3;2*1H
InChI key:InChIKey=FLAPOIMZRKQPSG-UHFFFAOYSA-N
SMILES:C(CN(CCC)CCC)C1CCCNC1.Cl
Synonyms:
  • 3-Piperidineethanamine, N,N-dipropyl-, hydrochloride (1:2)
  • N-(2-(PIPERIDIN-3-YL)ETHYL)-N-PROPYLPROPAN-1-AMINE DIHYDROCHLORIDE
  • N-[2-(3-Piperidinyl)ethyl]-N-propyl-1-propanaminedihydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.