CymitQuimica logo

CAS 1220035-68-6

:

Piperidine, 3-(2-chloro-4-methylphenoxy)-, hydrochloride (1:1)

Description:
Piperidine, 3-(2-chloro-4-methylphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 2-chloro-4-methylphenoxy substituent, indicating the presence of a chlorinated aromatic group that contributes to its chemical properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the chlorine atom and the methyl group on the aromatic ring can influence the compound's reactivity and interaction with biological targets. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully elucidate its biological activity, toxicity, and potential therapeutic applications. As with all chemical substances, proper handling and safety protocols should be observed due to potential hazards associated with its use.
Formula:C12H16ClNO·ClH
InChI:InChI=1S/C12H16ClNO.ClH/c1-9-4-5-12(11(13)7-9)15-10-3-2-6-14-8-10;/h4-5,7,10,14H,2-3,6,8H2,1H3;1H
InChI key:InChIKey=NNRPYZHBZQJRQD-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C=C(C)C=C1)C2CCCNC2.Cl
Synonyms:
  • Piperidine, 3-(2-chloro-4-methylphenoxy)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.