CymitQuimica logo

CAS 1220035-72-2

:

5-Bromo-N-cyclohexyl-4-methyl-2-pyridinamine

Description:
5-Bromo-N-cyclohexyl-4-methyl-2-pyridinamine is an organic compound characterized by its bromine substitution and a pyridine ring structure. The presence of the bromine atom at the 5-position of the pyridine ring contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The cyclohexyl group attached to the nitrogen atom enhances the compound's lipophilicity, which may influence its solubility in organic solvents and biological systems. The methyl group at the 4-position of the pyridine ring can also affect the compound's electronic properties and steric hindrance. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in the synthesis of more complex molecules or as a building block in pharmaceutical research. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H17BrN2
InChI:InChI=1S/C12H17BrN2/c1-9-7-12(14-8-11(9)13)15-10-5-3-2-4-6-10/h7-8,10H,2-6H2,1H3,(H,14,15)
InChI key:InChIKey=ZUTHEYKVUSYTHV-UHFFFAOYSA-N
SMILES:N(C1=CC(C)=C(Br)C=N1)C2CCCCC2
Synonyms:
  • 5-Bromo-N-cyclohexyl-4-methyl-2-pyridinamine
  • 2-Pyridinamine, 5-bromo-N-cyclohexyl-4-methyl-
  • 5-BROMO-N-CYCLOHEXYL-4-METHYLPYRIDIN-2-AMINE
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.