
CAS 1220035-78-8
:Propanamide, 2-amino-2-methyl-N-(phenylmethyl)-, hydrochloride (1:1)
Description:
Propanamide, 2-amino-2-methyl-N-(phenylmethyl)-, hydrochloride (1:1), also known as a specific amide derivative, is characterized by its structural features that include a propanamide backbone with an amino group and a phenylmethyl substituent. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents due to the presence of the amine and amide functional groups. The hydrochloride form indicates that it is a salt, which often enhances its stability and solubility in aqueous environments. The presence of the phenylmethyl group suggests potential for aromatic interactions, which may influence its biological activity and pharmacological properties. As with many amides, it may exhibit hydrogen bonding capabilities, affecting its melting point and boiling point. This compound could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. However, specific applications and safety profiles would require further investigation and analysis.
Formula:C11H16N2O·ClH
InChI:InChI=1S/C11H16N2O.ClH/c1-11(2,12)10(14)13-8-9-6-4-3-5-7-9;/h3-7H,8,12H2,1-2H3,(H,13,14);1H
InChI key:InChIKey=LWUQFUYISKBBMT-UHFFFAOYSA-N
SMILES:C(NC(C(C)(C)N)=O)C1=CC=CC=C1.Cl
Synonyms:- Propanamide, 2-amino-2-methyl-N-(phenylmethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.