
CAS 1220035-79-9
:Piperidine, 4-[(2-chloro-4-methylphenoxy)methyl]-, hydrochloride (1:1)
Description:
Piperidine, 4-[(2-chloro-4-methylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a chloro-substituted aromatic group, specifically a 2-chloro-4-methylphenoxy moiety, which is attached to the piperidine ring via a methylene (-CH2-) bridge. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it useful in various applications, including pharmaceuticals and chemical research. The presence of the chlorine atom and the methyl group on the aromatic ring can influence the compound's reactivity and biological activity. Piperidine derivatives are often studied for their potential pharmacological properties, including analgesic and anti-inflammatory effects. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C13H18ClNO·ClH
InChI:InChI=1S/C13H18ClNO.ClH/c1-10-2-3-13(12(14)8-10)16-9-11-4-6-15-7-5-11;/h2-3,8,11,15H,4-7,9H2,1H3;1H
InChI key:InChIKey=FDXWNSDLDXFGCY-UHFFFAOYSA-N
SMILES:O(CC1CCNCC1)C2=C(Cl)C=C(C)C=C2.Cl
Synonyms:- Piperidine, 4-[(2-chloro-4-methylphenoxy)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.