CAS 1220035-82-4

Ethyl 3-amino-4-[(2-pyridinylmethyl)amino]benzoate

Description:

Ethyl 3-amino-4-[(2-pyridinylmethyl)amino]benzoate, identified by its CAS number 1220035-82-4, is a chemical compound that features a benzoate structure with amino groups and a pyridine moiety. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its role as a building block in drug development. The presence of the ethyl ester group contributes to its solubility and reactivity, while the amino groups can participate in hydrogen bonding and other interactions, influencing its pharmacological properties. The pyridine ring adds to the compound's aromatic character and may enhance its interaction with biological targets. Overall, this compound's unique structure suggests potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography to ensure the desired purity and yield.

Formula: C₁₅H₁₇N₃O₂

InChI: InChI=1S/C15H17N3O2/c1-2-20-15(19)11-6-7-14(13(16)9-11)18-10-12-5-3-4-8-17-12/h3-9,18H,2,10,16H2,1H3

InChI key: InChIKey=ZIJPIELRMVRZGE-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CC(N)=C(NCC2=CC=CC=N2)C=C1

Synonyms:

• Ethyl 3-amino-4-[(2-pyridinylmethyl)amino]benzoate
• Benzoic acid, 3-amino-4-[(2-pyridinylmethyl)amino]-, ethyl ester