CAS 1220035-84-6

2-[(3-Pyridinyloxy)methyl]benzoic acid

Description:

2-[(3-Pyridinyloxy)methyl]benzoic acid, identified by its CAS number 1220035-84-6, is an organic compound characterized by the presence of both a benzoic acid moiety and a pyridine derivative. This compound features a pyridinyloxy group attached to a benzene ring through a methylene bridge, which contributes to its unique chemical properties. It typically exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, while the pyridine ring can enhance its interaction with biological systems, potentially influencing its pharmacological activity. The compound may participate in hydrogen bonding due to the carboxylic acid and the nitrogen atom in the pyridine ring, which can affect its reactivity and stability. Additionally, its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Overall, the combination of functional groups in 2-[(3-Pyridinyloxy)methyl]benzoic acid makes it a compound of interest for further research and application in various chemical and biological contexts.

Formula: C₁₃H₁₁NO₃

InChI: InChI=1S/C13H11NO3/c15-13(16)12-6-2-1-4-10(12)9-17-11-5-3-7-14-8-11/h1-8H,9H2,(H,15,16)

InChI key: InChIKey=RQKQMTIIYQABDD-UHFFFAOYSA-N

SMILES: C(OC=1C=CC=NC1)C2=C(C(O)=O)C=CC=C2

Synonyms:

• 2-[(3-Pyridinyloxy)methyl]benzoic acid
• Benzoic acid, 2-[(3-pyridinyloxy)methyl]-