CAS 1220035-90-4

Piperidine, 4-[[2-chloro-4-(1,1-dimethylpropyl)phenoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[[2-chloro-4-(1,1-dimethylpropyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a chloro-substituted phenoxy group, indicating the presence of a chlorine atom on the aromatic ring, which is further substituted with a bulky 1,1-dimethylpropyl group. The hydrochloride form suggests that the compound is a salt, enhancing its solubility in water and making it suitable for various applications, including pharmaceutical formulations. The presence of the hydrochloride indicates that it can exist in a protonated state, which may influence its biological activity and stability. This compound may exhibit properties typical of piperidine derivatives, such as potential interactions with neurotransmitter systems, making it of interest in medicinal chemistry. However, specific biological activities, toxicity, and pharmacokinetics would require further investigation through empirical studies.

Formula: C₁₇H₂₆ClNO·ClH

InChI: InChI=1S/C17H26ClNO.ClH/c1-4-17(2,3)14-5-6-16(15(18)11-14)20-12-13-7-9-19-10-8-13;/h5-6,11,13,19H,4,7-10,12H2,1-3H3;1H

InChI key: InChIKey=MVYYSCHYETWCNW-UHFFFAOYSA-N

SMILES: C(CC)(C)(C)C1=CC(Cl)=C(OCC2CCNCC2)C=C1.Cl

Synonyms:

• Piperidine, 4-[[2-chloro-4-(1,1-dimethylpropyl)phenoxy]methyl]-, hydrochloride (1:1)