CAS 1220036-02-1

Piperidine, 4-[2-chloro-4-(1-methyl-1-phenylethyl)phenoxy]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-chloro-4-(1-methyl-1-phenylethyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a chloro-substituted phenyl group and a phenoxy moiety, indicating the presence of a phenol derivative linked to the piperidine structure. The hydrochloride form suggests that the compound is a salt, which typically enhances its solubility in water and stability. The presence of the 1-methyl-1-phenylethyl group indicates potential steric hindrance, which may influence its biological activity and interactions. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular structure and the presence of functional groups. As with many piperidine derivatives, it may interact with various biological targets, potentially serving as a lead compound in drug development. Safety and handling precautions should be observed due to its chemical nature.

Formula: C₂₀H₂₄ClNO·ClH

InChI: InChI=1S/C20H24ClNO.ClH/c1-20(2,15-6-4-3-5-7-15)16-8-9-19(18(21)14-16)23-17-10-12-22-13-11-17;/h3-9,14,17,22H,10-13H2,1-2H3;1H

InChI key: InChIKey=BWGDSFSSUXURMK-UHFFFAOYSA-N

SMILES: C(C)(C)(C1=CC(Cl)=C(OC2CCNCC2)C=C1)C3=CC=CC=C3.Cl

Synonyms:

• Piperidine, 4-[2-chloro-4-(1-methyl-1-phenylethyl)phenoxy]-, hydrochloride (1:1)