CAS 1220036-04-3

2-Pyrrolidinemethanamine, N-methyl-N-(phenylmethyl)-, hydrochloride (1:2)

Description:

2-Pyrrolidinemethanamine, N-methyl-N-(phenylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its structural features, which include a pyrrolidine ring and a phenylmethyl group. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in pharmaceutical and chemical research. The presence of the N-methyl and phenylmethyl substituents contributes to its potential biological activity, possibly influencing its interaction with biological targets. The compound may exhibit properties such as basicity due to the amine functional group, and it may participate in hydrogen bonding, affecting its reactivity and solubility. As with many amines, it may also display chiral characteristics depending on the specific stereochemistry of the substituents. Safety and handling precautions are essential, as with all chemical substances, particularly those with potential pharmacological effects. Further studies would be necessary to fully elucidate its properties and potential applications in medicinal chemistry or related fields.

Formula: C₁₃H₂₀N₂·2ClH

InChI: InChI=1S/C13H20N2.2ClH/c1-15(11-13-8-5-9-14-13)10-12-6-3-2-4-7-12;;/h2-4,6-7,13-14H,5,8-11H2,1H3;2*1H

InChI key: InChIKey=QADVQRSXDCLVTN-UHFFFAOYSA-N

SMILES: C(N(CC1CCCN1)C)C2=CC=CC=C2.Cl

Synonyms:

• 2-Pyrrolidinemethanamine, N-methyl-N-(phenylmethyl)-, hydrochloride (1:2)