CAS 1220036-18-9
:5-Bromo-3-methyl-2-(2-methyl-1-piperidinyl)pyridine
Description:
5-Bromo-3-methyl-2-(2-methyl-1-piperidinyl)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methyl group at the 3-position contributes to its unique reactivity and physical properties. The compound also features a 2-methyl-1-piperidinyl substituent, which introduces a piperidine ring that enhances its potential for biological activity. This structure suggests that the compound may exhibit lipophilicity, allowing it to interact with biological membranes. Its molecular configuration may influence its pharmacological properties, making it of interest in medicinal chemistry. The compound's CAS number, 1220036-18-9, allows for easy identification in chemical databases. Overall, 5-Bromo-3-methyl-2-(2-methyl-1-piperidinyl)pyridine is a complex organic molecule that may have applications in drug development or as a research tool in various chemical and biological studies.
Formula:C12H17BrN2
InChI:InChI=1S/C12H17BrN2/c1-9-7-11(13)8-14-12(9)15-6-4-3-5-10(15)2/h7-8,10H,3-6H2,1-2H3
InChI key:InChIKey=TUBTXQSYOBRPMJ-UHFFFAOYSA-N
SMILES:CC1=C(N=CC(Br)=C1)N2C(C)CCCC2
Synonyms:- 5-Bromo-3-methyl-2-(2-methyl-1-piperidinyl)pyridine
- Pyridine, 5-bromo-3-methyl-2-(2-methyl-1-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.