CymitQuimica logo

CAS 1220036-19-0

:

5-Bromo-2-(2-ethyl-1-piperidinyl)-4-methylpyridine

Description:
5-Bromo-2-(2-ethyl-1-piperidinyl)-4-methylpyridine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a piperidine moiety. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The piperidine group contributes to its basicity and can influence its solubility in organic solvents. This compound may exhibit biological activity, potentially serving as a pharmacophore in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric disorders. Its molecular structure suggests that it may interact with biological systems through mechanisms involving receptor binding or enzyme inhibition. Additionally, the presence of the ethyl group on the piperidine ring can enhance lipophilicity, affecting its pharmacokinetic properties. Overall, 5-Bromo-2-(2-ethyl-1-piperidinyl)-4-methylpyridine is a compound of interest in both synthetic and medicinal chemistry due to its structural features and potential applications.
Formula:C13H19BrN2
InChI:InChI=1S/C13H19BrN2/c1-3-11-6-4-5-7-16(11)13-8-10(2)12(14)9-15-13/h8-9,11H,3-7H2,1-2H3
InChI key:InChIKey=ONQSNNIDGVCBFT-UHFFFAOYSA-N
SMILES:C(C)C1N(CCCC1)C2=CC(C)=C(Br)C=N2
Synonyms:
  • 5-Bromo-2-(2-ethyl-1-piperidinyl)-4-methylpyridine
  • Pyridine, 5-bromo-2-(2-ethyl-1-piperidinyl)-4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.