CAS 1220036-24-7

6-Chloro-N,N-di-2-propen-1-yl-4-pyrimidinamine

Description:

6-Chloro-N,N-di-2-propen-1-yl-4-pyrimidinamine is a chemical compound characterized by its pyrimidine ring, which is a six-membered aromatic heterocycle containing nitrogen atoms. The presence of a chlorine atom at the 6-position of the pyrimidine ring contributes to its reactivity and potential biological activity. The compound features two propenyl groups attached to the nitrogen atoms, which can influence its solubility and interaction with biological targets. This structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit antimicrobial or anticancer properties. The molecular structure allows for various functionalization possibilities, making it a versatile candidate for further chemical modifications. Additionally, the compound's stability, reactivity, and interaction with other molecules can be influenced by environmental factors such as pH and temperature. Overall, 6-Chloro-N,N-di-2-propen-1-yl-4-pyrimidinamine represents a class of compounds with significant potential in research and application within the field of organic and medicinal chemistry.

Formula: C₁₀H₁₂ClN₃

InChI: InChI=1S/C10H12ClN3/c1-3-5-14(6-4-2)10-7-9(11)12-8-13-10/h3-4,7-8H,1-2,5-6H2

InChI key: InChIKey=BWAALBRZWRTHHR-UHFFFAOYSA-N

SMILES: N(CC=C)(CC=C)C=1C=C(Cl)N=CN1

Synonyms:

• 6-Chloro-N,N-di-2-propen-1-yl-4-pyrimidinamine
• 4-Pyrimidinamine, 6-chloro-N,N-di-2-propen-1-yl-