CAS 1220036-27-0
:4-(6-Chloro-4-pyrimidinyl)-1-piperazineethanol
Description:
4-(6-Chloro-4-pyrimidinyl)-1-piperazineethanol is a chemical compound characterized by its unique structure, which includes a piperazine ring and a pyrimidine moiety. The presence of a chlorine atom at the 6-position of the pyrimidine ring contributes to its reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound, and its functional groups suggest it may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. The hydroxyl group (-OH) in the ethanol part of the molecule can participate in hydrogen bonding, influencing its solubility and interaction with biological targets. Additionally, the piperazine ring is known for its role in various drug formulations, often enhancing pharmacological properties. Overall, this compound's characteristics make it of interest in research, particularly in the fields of drug discovery and development, where its structural features may correlate with specific therapeutic effects.
Formula:C10H15ClN4O
InChI:InChI=1S/C10H15ClN4O/c11-9-7-10(13-8-12-9)15-3-1-14(2-4-15)5-6-16/h7-8,16H,1-6H2
InChI key:InChIKey=GWLPIJNIFCQNLA-UHFFFAOYSA-N
SMILES:ClC1=CC(=NC=N1)N2CCN(CCO)CC2
Synonyms:- 4-(6-Chloro-4-pyrimidinyl)-1-piperazineethanol
- 1-Piperazineethanol, 4-(6-chloro-4-pyrimidinyl)-
- 2-[4-(6-Chloro-4-pyrimidinyl)-1-piperazinyl]-1-ethanol
- 2-(4-(6-chloropyrimidin-4-yl)piperazin-1-yl)ethan-1-ol
- 2-(4-(6-CHLOROPYRIMIDIN-4-YL)PIPERAZIN-1-YL)ETHANOL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.