CAS 1220036-28-1

6-Chloro-N-cyclohexyl-N-methyl-2-pyridinamine

Description:

6-Chloro-N-cyclohexyl-N-methyl-2-pyridinamine is a chemical compound characterized by its specific functional groups and structural features. It contains a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom, and is substituted at the 2-position with an amino group. The presence of a chlorine atom at the 6-position contributes to its reactivity and potential biological activity. The compound also features a cyclohexyl group and a methyl group attached to the nitrogen atoms, which can influence its solubility and interaction with biological systems. This compound may exhibit properties typical of amines, such as basicity, and can participate in various chemical reactions, including nucleophilic substitutions. Its unique structure suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activity would require further investigation. As with many nitrogen-containing compounds, it may also be subject to regulations regarding its use and handling due to potential toxicity or environmental impact.

Formula: C₁₂H₁₇ClN₂

InChI: InChI=1S/C12H17ClN2/c1-15(10-6-3-2-4-7-10)12-9-5-8-11(13)14-12/h5,8-10H,2-4,6-7H2,1H3

InChI key: InChIKey=YBJOPZJADJTHJX-UHFFFAOYSA-N

SMILES: N(C)(C=1N=C(Cl)C=CC1)C2CCCCC2

Synonyms:

• 6-Chloro-N-cyclohexyl-N-methyl-2-pyridinamine
• 2-Pyridinamine, 6-chloro-N-cyclohexyl-N-methyl-