
CAS 1220036-29-2
:6-Chloro-N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-4-pyrimidinamine
Description:
6-Chloro-N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-4-pyrimidinamine is a chemical compound characterized by its complex structure, which includes a pyrimidine ring, a chloro substituent, and a tetrahydro-pyran moiety. The presence of the chloro group suggests potential reactivity and influences the compound's biological activity. The N-methyl and N-[(tetrahydro-2H-pyran-4-yl)methyl] substituents contribute to the compound's lipophilicity, which can affect its solubility and permeability in biological systems. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways. Its molecular structure indicates potential interactions with biological targets, which could be explored in drug discovery. Additionally, the compound's stability, reactivity, and potential for forming hydrogen bonds are important characteristics that can influence its behavior in various chemical environments. Overall, this compound represents a unique scaffold that may have applications in pharmaceutical research.
Formula:C11H16ClN3O
InChI:InChI=1S/C11H16ClN3O/c1-15(7-9-2-4-16-5-3-9)11-6-10(12)13-8-14-11/h6,8-9H,2-5,7H2,1H3
InChI key:InChIKey=HCEZMHMJCORFKK-UHFFFAOYSA-N
SMILES:N(CC1CCOCC1)(C)C=2C=C(Cl)N=CN2
Synonyms:- 4-Pyrimidinamine, 6-chloro-N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-
- 6-Chloro-N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-4-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.