CymitQuimica logo

CAS 1220036-30-5

:

1-(6-Chloro-2-pyridinyl)-2,3-dihydro-1H-indole

Description:
1-(6-Chloro-2-pyridinyl)-2,3-dihydro-1H-indole is a chemical compound characterized by its unique structure, which includes a pyridine ring and an indole moiety. The presence of the chloro substituent at the 6-position of the pyridine ring contributes to its reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound, which often exhibits interesting pharmacological properties. Its molecular structure suggests potential interactions with biological targets, making it a candidate for research in medicinal chemistry. The dihydroindole portion of the molecule indicates that it may participate in various chemical reactions, including those involving electrophilic or nucleophilic sites. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, particularly the chloro and pyridinyl groups. Overall, 1-(6-Chloro-2-pyridinyl)-2,3-dihydro-1H-indole represents a class of compounds that may have applications in drug development and other fields of chemical research.
Formula:C13H11ClN2
InChI:InChI=1S/C13H11ClN2/c14-12-6-3-7-13(15-12)16-9-8-10-4-1-2-5-11(10)16/h1-7H,8-9H2
InChI key:InChIKey=BLRVCCLFVLQHOB-UHFFFAOYSA-N
SMILES:ClC1=NC(N2C=3C(CC2)=CC=CC3)=CC=C1
Synonyms:
  • 1-(6-Chloro-2-pyridinyl)-2,3-dihydro-1H-indole
  • 1H-Indole, 1-(6-chloro-2-pyridinyl)-2,3-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.