
CAS 1220036-47-4
:Ethanone, 2-amino-1-(2-methyl-1-piperidinyl)-, hydrochloride (1:1)
Description:
Ethanone, 2-amino-1-(2-methyl-1-piperidinyl)-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its amine and ketone functional groups. This substance features a piperidine ring, which contributes to its cyclic structure and potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit properties relevant to medicinal chemistry, including potential effects on neurotransmitter systems, given the structural motifs associated with psychoactive substances. Its molecular structure allows for interactions with various biological targets, making it of interest in drug development. Safety and handling precautions are essential, as with all chemical substances, particularly those with potential pharmacological effects.
Formula:C8H16N2O·ClH
InChI:InChI=1S/C8H16N2O.ClH/c1-7-4-2-3-5-10(7)8(11)6-9;/h7H,2-6,9H2,1H3;1H
InChI key:InChIKey=NAPIHEAGGWXAHW-UHFFFAOYSA-N
SMILES:C(CN)(=O)N1C(C)CCCC1.Cl
Synonyms:- Ethanone, 2-amino-1-(2-methyl-1-piperidinyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.