
CAS 1220036-50-9
:Pyrrolidine, 3-[(2-ethoxyethoxy)methyl]-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-[(2-ethoxyethoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of the 2-ethoxyethoxy group indicates that it has ether functionalities, contributing to its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and organic synthesis. The compound may exhibit properties such as basicity due to the nitrogen atom in the pyrrolidine ring, which can participate in hydrogen bonding and interact with other molecules. Its structure suggests potential uses in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other biological pathways. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C9H19NO2·ClH
InChI:InChI=1S/C9H19NO2.ClH/c1-2-11-5-6-12-8-9-3-4-10-7-9;/h9-10H,2-8H2,1H3;1H
InChI key:InChIKey=HAELQRSUFAIEPB-UHFFFAOYSA-N
SMILES:C(OCCOCC)C1CCNC1.Cl
Synonyms:- Pyrrolidine, 3-[(2-ethoxyethoxy)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.