CAS 1220036-57-6

Piperidine, 4-[2-(3-methylbutoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-(3-methylbutoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a 3-methylbutoxy group attached to the 4-position of the piperidine ring, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it useful in various applications, including pharmaceuticals and organic synthesis. The presence of the alkoxy group may influence its biological activity and interaction with other molecules. Piperidine derivatives are known for their role in medicinal chemistry, often exhibiting properties such as analgesic, anti-inflammatory, or antimicrobial activities. Safety data for this compound would indicate standard precautions due to potential irritant effects, and it should be handled in accordance with safety guidelines for chemical substances. Overall, this compound exemplifies the diverse functionality of piperidine derivatives in chemical research and development.

Formula: C₁₂H₂₅NO·ClH

InChI: InChI=1S/C12H25NO.ClH/c1-11(2)5-9-14-10-6-12-3-7-13-8-4-12;/h11-13H,3-10H2,1-2H3;1H

InChI key: InChIKey=ZSSIDDHUNYBKRT-UHFFFAOYSA-N

SMILES: C(COCCC(C)C)C1CCNCC1.Cl

Synonyms:

• Piperidine, 4-[2-(3-methylbutoxy)ethyl]-, hydrochloride (1:1)