
CAS 1220036-61-2
:Piperidine, 3-[2-(2-propen-1-yloxy)ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[2-(2-propen-1-yloxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a side chain with a propenyloxy group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which enhances its utility in various chemical processes. The presence of the propenyloxy group suggests potential for further chemical modifications, making it a versatile intermediate in the synthesis of more complex molecules. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety data should be consulted for handling, as piperidine derivatives can exhibit biological activity and may pose health risks. Overall, this compound is of interest in research and development within the fields of pharmaceuticals and organic chemistry.
Formula:C10H19NO·ClH
InChI:InChI=1S/C10H19NO.ClH/c1-2-7-12-8-5-10-4-3-6-11-9-10;/h2,10-11H,1,3-9H2;1H
InChI key:InChIKey=PZYIOESLJFEKBD-UHFFFAOYSA-N
SMILES:C(COCC=C)C1CCCNC1.Cl
Synonyms:- Piperidine, 3-[2-(2-propen-1-yloxy)ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.