CAS 1220036-85-0

Pyrimidine, 4-chloro-6-(4-piperidinylmethoxy)-, hydrochloride (1:1)

Description:

Pyrimidine, 4-chloro-6-(4-piperidinylmethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the 4-position and a piperidinylmethoxy group at the 6-position contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its structural features suggest potential interactions with biological targets, which could be explored in drug discovery processes. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to elucidate its specific mechanisms of action and therapeutic potential.

Formula: C₁₀H₁₄ClN₃O·ClH

InChI: InChI=1S/C10H14ClN3O.ClH/c11-9-5-10(14-7-13-9)15-6-8-1-3-12-4-2-8;/h5,7-8,12H,1-4,6H2;1H

InChI key: InChIKey=JUHYKXGAIXLHHL-UHFFFAOYSA-N

SMILES: O(CC1CCNCC1)C=2C=C(Cl)N=CN2.Cl

Synonyms:

• Pyrimidine, 4-chloro-6-(4-piperidinylmethoxy)-, hydrochloride (1:1)