CAS 1220037-02-4

4-Pyridinecarboxylic acid, 3-piperidinylmethyl ester, hydrochloride (1:1)

Description:

4-Pyridinecarboxylic acid, 3-piperidinylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its pyridine and piperidine functional groups, which contribute to its potential biological activity. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, reflecting its ionic nature due to the hydrochloride salt form. The presence of the piperidinylmethyl ester moiety suggests that it may exhibit properties relevant to medicinal chemistry, potentially acting as a ligand or modulator in biological systems. Its hydrochloride form enhances its stability and solubility, making it suitable for various applications, including pharmaceutical research. The compound's molecular structure allows for interactions with biological targets, which may lead to pharmacological effects. As with many chemical substances, safety data and handling precautions should be observed, as it may pose risks associated with its chemical reactivity and biological activity. Further studies would be necessary to fully elucidate its properties and potential applications in drug development or other fields.

Formula: C₁₂H₁₆N₂O₂·ClH

InChI: InChI=1S/C12H16N2O2.ClH/c15-12(11-3-6-13-7-4-11)16-9-10-2-1-5-14-8-10;/h3-4,6-7,10,14H,1-2,5,8-9H2;1H

InChI key: InChIKey=FBGAMYRLJQBSLT-UHFFFAOYSA-N

SMILES: C(OCC1CCCNC1)(=O)C=2C=CN=CC2.Cl

Synonyms:

• 4-Pyridinecarboxylic acid, 3-piperidinylmethyl ester, hydrochloride (1:1)