CAS 1220037-07-9

Piperidine, 4-[2-([1,1′-biphenyl]-2-yloxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-([1,1′-biphenyl]-2-yloxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a biphenyl moiety, indicating the presence of two phenyl rings connected by a single bond, which contributes to its structural complexity and potential biological activity. The hydrochloride form indicates that the compound is a salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the ether linkage (the biphenyl-2-yloxy group) suggests potential interactions with biological targets, which may be of interest in medicinal chemistry. As with many piperidine derivatives, it may exhibit properties such as analgesic, anti-inflammatory, or neuroactive effects, although specific biological activities would require empirical investigation. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential pharmacological effects.

Formula: C₁₉H₂₃NO·ClH

InChI: InChI=1S/C19H23NO.ClH/c1-2-6-17(7-3-1)18-8-4-5-9-19(18)21-15-12-16-10-13-20-14-11-16;/h1-9,16,20H,10-15H2;1H

InChI key: InChIKey=PFKJQUGRCNCODS-UHFFFAOYSA-N

SMILES: O(CCC1CCNCC1)C2=C(C=CC=C2)C3=CC=CC=C3.Cl

Synonyms:

• Piperidine, 4-[2-([1,1′-biphenyl]-2-yloxy)ethyl]-, hydrochloride (1:1)