
CAS 1220037-15-9
:Pyrrolidine, 3-[[2-(2-propen-1-yl)phenoxy]methyl]-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-[[2-(2-propen-1-yl)phenoxy]methyl]-, hydrochloride (1:1), identified by CAS number 1220037-15-9, is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. This compound features a phenoxy group substituted with a propenyl moiety, contributing to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the propenyl group may impart specific properties such as increased lipophilicity or the ability to participate in further chemical reactions, making it of interest in medicinal chemistry. Its structural characteristics suggest potential interactions with biological targets, which could be explored in drug development. However, detailed studies on its pharmacological properties, toxicity, and specific applications would be necessary to fully understand its behavior in biological systems and its potential therapeutic uses.
Formula:C14H19NO·ClH
InChI:InChI=1S/C14H19NO.ClH/c1-2-5-13-6-3-4-7-14(13)16-11-12-8-9-15-10-12;/h2-4,6-7,12,15H,1,5,8-11H2;1H
InChI key:InChIKey=ALPVPXHYXNFCAL-UHFFFAOYSA-N
SMILES:O(CC1CCNC1)C2=C(CC=C)C=CC=C2.Cl
Synonyms:- Pyrrolidine, 3-[[2-(2-propen-1-yl)phenoxy]methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.